C20H12Br2O3S — CID 102368347
(3R,4S)-3-benzoyl-6-bromo-4-(5-bromothiophen-2-yl)-3,4-dihydrochromen-2-one (PubChem CID 102368347) has the molecular formula C20H12Br2O3S and a molecular weight of 492.19 g/mol. Its IUPAC name is (3R,4S)-3-benzoyl-6-bromo-4-(5-bromothiophen-2-yl)-3,4-dihydrochromen-2-one.
| Compound Name | (3R,4S)-3-benzoyl-6-bromo-4-(5-bromothiophen-2-yl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 102368347 |
| Molecular Formula | C20H12Br2O3S |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 489.89 |
| IUPAC Name | (3R,4S)-3-benzoyl-6-bromo-4-(5-bromothiophen-2-yl)-3,4-dihydrochromen-2-one |
| SMILES | O=C1Oc2ccc(Br)cc2[C@@H](c2ccc(Br)s2)[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H12Br2O3S/c21-12-6-7-14-13(10-12)17(15-8-9-16(22)26-15)18(20(24)25-14)19(23)11-4-2-1-3-5-11/h1-10,17-18H/t17-,18+/m0/s1 |
| InChIKey | YSHVUGOSCMZUDE-ZWKOTPCHSA-N |
| XLogP | 5.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|