C20H17BrO5 — CID 26517538
methyl (3S,4R)-6-bromo-2-oxo-4-[(2R)-1-oxo-1-phenylpropan-2-yl]-3,4-dihydrochromene-3-carboxylate (PubChem CID 26517538) has the molecular formula C20H17BrO5 and a molecular weight of 417.26 g/mol. Its IUPAC name is methyl (3S,4R)-6-bromo-2-oxo-4-[(2R)-1-oxo-1-phenylpropan-2-yl]-3,4-dihydrochromene-3-carboxylate.
| Compound Name | methyl (3S,4R)-6-bromo-2-oxo-4-[(2R)-1-oxo-1-phenylpropan-2-yl]-3,4-dihydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 26517538 |
| Molecular Formula | C20H17BrO5 |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | methyl (3S,4R)-6-bromo-2-oxo-4-[(2R)-1-oxo-1-phenylpropan-2-yl]-3,4-dihydrochromene-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)Oc2ccc(Br)cc2[C@@H]1[C@@H](C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H17BrO5/c1-11(18(22)12-6-4-3-5-7-12)16-14-10-13(21)8-9-15(14)26-20(24)17(16)19(23)25-2/h3-11,16-17H,1-2H3/t11-,16+,17+/m1/s1 |
| InChIKey | MRXREZNWTOUTPH-NVGVWMPQSA-N |
| XLogP | 3.76 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|