C22H21BrO5 — CID 6553820
methyl (3R,4S)-6-bromo-4-[(2S)-1-(4-methylphenyl)-1-oxobutan-2-yl]-2-oxo-3,4-dihydrochromene-3-carboxylate (PubChem CID 6553820) has the molecular formula C22H21BrO5 and a molecular weight of 445.31 g/mol. Its IUPAC name is methyl (3R,4S)-6-bromo-4-[(2S)-1-(4-methylphenyl)-1-oxobutan-2-yl]-2-oxo-3,4-dihydrochromene-3-carboxylate.
| Compound Name | methyl (3R,4S)-6-bromo-4-[(2S)-1-(4-methylphenyl)-1-oxobutan-2-yl]-2-oxo-3,4-dihydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 6553820 |
| Molecular Formula | C22H21BrO5 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | methyl (3R,4S)-6-bromo-4-[(2S)-1-(4-methylphenyl)-1-oxobutan-2-yl]-2-oxo-3,4-dihydrochromene-3-carboxylate |
| SMILES | CC[C@H](C(=O)c1ccc(C)cc1)[C@@H]1c2cc(Br)ccc2OC(=O)[C@H]1C(=O)OC |
| InChI | InChI=1S/C22H21BrO5/c1-4-15(20(24)13-7-5-12(2)6-8-13)18-16-11-14(23)9-10-17(16)28-22(26)19(18)21(25)27-3/h5-11,15,18-19H,4H2,1-3H3/t15-,18+,19+/m0/s1 |
| InChIKey | NNCHOCPXJJOWSP-KFKAGJAMSA-N |
| XLogP | 4.46 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|