C22H19BrO5 — CID 98063031
ethyl (1R,1aS,7bR)-6-bromo-1-methyl-1-(4-methylbenzoyl)-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate (PubChem CID 98063031) has the molecular formula C22H19BrO5 and a molecular weight of 443.29 g/mol. Its IUPAC name is ethyl (1R,1aS,7bR)-6-bromo-1-methyl-1-(4-methylbenzoyl)-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate.
| Compound Name | ethyl (1R,1aS,7bR)-6-bromo-1-methyl-1-(4-methylbenzoyl)-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate |
|---|---|
| PubChem CID | 98063031 |
| Molecular Formula | C22H19BrO5 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | ethyl (1R,1aS,7bR)-6-bromo-1-methyl-1-(4-methylbenzoyl)-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate |
| SMILES | CCOC(=O)[C@]12C(=O)Oc3ccc(Br)cc3[C@@H]1[C@@]2(C)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H19BrO5/c1-4-27-19(25)22-17(15-11-14(23)9-10-16(15)28-20(22)26)21(22,3)18(24)13-7-5-12(2)6-8-13/h5-11,17H,4H2,1-3H3/t17-,21+,22+/m1/s1 |
| InChIKey | BFZUDWWDMZJZKM-WTNAPCKOSA-N |
| XLogP | 4.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|