C21H17BrO4 — CID 7303503
(1R,1aS,7bS)-1a-acetyl-6-bromo-1-methyl-1-(4-methylbenzoyl)-7bH-cyclopropa[c]chromen-2-one (PubChem CID 7303503) has the molecular formula C21H17BrO4 and a molecular weight of 413.27 g/mol. Its IUPAC name is (1R,1aS,7bS)-1a-acetyl-6-bromo-1-methyl-1-(4-methylbenzoyl)-7bH-cyclopropa[c]chromen-2-one.
| Compound Name | (1R,1aS,7bS)-1a-acetyl-6-bromo-1-methyl-1-(4-methylbenzoyl)-7bH-cyclopropa[c]chromen-2-one |
|---|---|
| PubChem CID | 7303503 |
| Molecular Formula | C21H17BrO4 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | (1R,1aS,7bS)-1a-acetyl-6-bromo-1-methyl-1-(4-methylbenzoyl)-7bH-cyclopropa[c]chromen-2-one |
| SMILES | CC(=O)[C@]12C(=O)Oc3ccc(Br)cc3[C@H]1[C@@]2(C)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H17BrO4/c1-11-4-6-13(7-5-11)18(24)20(3)17-15-10-14(22)8-9-16(15)26-19(25)21(17,20)12(2)23/h4-10,17H,1-3H3/t17-,20-,21+/m0/s1 |
| InChIKey | FRBJFTYWUVKZFU-DZFGPLHGSA-N |
| XLogP | 4.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|