C21H17BrO5 — CID 27044156
methyl (1R,1aS,7bS)-6-bromo-1-methyl-1-(4-methylbenzoyl)-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate (PubChem CID 27044156) has the molecular formula C21H17BrO5 and a molecular weight of 429.27 g/mol. Its IUPAC name is methyl (1R,1aS,7bS)-6-bromo-1-methyl-1-(4-methylbenzoyl)-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate.
| Compound Name | methyl (1R,1aS,7bS)-6-bromo-1-methyl-1-(4-methylbenzoyl)-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate |
|---|---|
| PubChem CID | 27044156 |
| Molecular Formula | C21H17BrO5 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | methyl (1R,1aS,7bS)-6-bromo-1-methyl-1-(4-methylbenzoyl)-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate |
| SMILES | COC(=O)[C@]12C(=O)Oc3ccc(Br)cc3[C@H]1[C@@]2(C)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H17BrO5/c1-11-4-6-12(7-5-11)17(23)20(2)16-14-10-13(22)8-9-15(14)27-19(25)21(16,20)18(24)26-3/h4-10,16H,1-3H3/t16-,20-,21-/m0/s1 |
| InChIKey | LKUVEEAONGORLW-NDXORKPFSA-N |
| XLogP | 3.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|