C21H16BrFO5 — CID 98058075
methyl (1R,1aS,7bR)-6-bromo-1-ethyl-1-(4-fluorobenzoyl)-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate (PubChem CID 98058075) has the molecular formula C21H16BrFO5 and a molecular weight of 447.26 g/mol. Its IUPAC name is methyl (1R,1aS,7bR)-6-bromo-1-ethyl-1-(4-fluorobenzoyl)-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate.
| Compound Name | methyl (1R,1aS,7bR)-6-bromo-1-ethyl-1-(4-fluorobenzoyl)-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate |
|---|---|
| PubChem CID | 98058075 |
| Molecular Formula | C21H16BrFO5 |
| Molecular Weight | 447.26 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | methyl (1R,1aS,7bR)-6-bromo-1-ethyl-1-(4-fluorobenzoyl)-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate |
| SMILES | CC[C@@]1(C(=O)c2ccc(F)cc2)[C@H]2c3cc(Br)ccc3OC(=O)[C@@]21C(=O)OC |
| InChI | InChI=1S/C21H16BrFO5/c1-3-20(17(24)11-4-7-13(23)8-5-11)16-14-10-12(22)6-9-15(14)28-19(26)21(16,20)18(25)27-2/h4-10,16H,3H2,1-2H3/t16-,20+,21+/m1/s1 |
| InChIKey | BCBIYPMOHATPKE-CZAAIQMYSA-N |
| XLogP | 4.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|