C25H24BrClO5 — CID 98456337
3-methylbutyl (1S,1aR,7bR)-6-bromo-1-(4-chlorobenzoyl)-1-ethyl-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate (PubChem CID 98456337) has the molecular formula C25H24BrClO5 and a molecular weight of 519.82 g/mol. Its IUPAC name is 3-methylbutyl (1S,1aR,7bR)-6-bromo-1-(4-chlorobenzoyl)-1-ethyl-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate.
| Compound Name | 3-methylbutyl (1S,1aR,7bR)-6-bromo-1-(4-chlorobenzoyl)-1-ethyl-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate |
|---|---|
| PubChem CID | 98456337 |
| Molecular Formula | C25H24BrClO5 |
| Molecular Weight | 519.82 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 3-methylbutyl (1S,1aR,7bR)-6-bromo-1-(4-chlorobenzoyl)-1-ethyl-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxylate |
| SMILES | CC[C@]1(C(=O)c2ccc(Cl)cc2)[C@H]2c3cc(Br)ccc3OC(=O)[C@]21C(=O)OCCC(C)C |
| InChI | InChI=1S/C25H24BrClO5/c1-4-24(21(28)15-5-8-17(27)9-6-15)20-18-13-16(26)7-10-19(18)32-23(30)25(20,24)22(29)31-12-11-14(2)3/h5-10,13-14,20H,4,11-12H2,1-3H3/t20-,24-,25-/m1/s1 |
| InChIKey | QAJTXGNCNGRQOA-NIJXNBFTSA-N |
| XLogP | 5.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.82 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|