C25H19BrO5 — CID 1315635
methyl (13R,14S,15R)-14-(4-bromobenzoyl)-14-ethyl-12-oxo-11-oxatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8-pentaene-13-carboxylate (PubChem CID 1315635) has the molecular formula C25H19BrO5 and a molecular weight of 479.33 g/mol. Its IUPAC name is methyl (13R,14S,15R)-14-(4-bromobenzoyl)-14-ethyl-12-oxo-11-oxatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8-pentaene-13-carboxylate.
| Compound Name | methyl (13R,14S,15R)-14-(4-bromobenzoyl)-14-ethyl-12-oxo-11-oxatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8-pentaene-13-carboxylate |
|---|---|
| PubChem CID | 1315635 |
| Molecular Formula | C25H19BrO5 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | methyl (13R,14S,15R)-14-(4-bromobenzoyl)-14-ethyl-12-oxo-11-oxatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8-pentaene-13-carboxylate |
| SMILES | CC[C@]1(C(=O)c2ccc(Br)cc2)[C@H]2c3c(ccc4ccccc34)OC(=O)[C@]21C(=O)OC |
| InChI | InChI=1S/C25H19BrO5/c1-3-24(21(27)15-8-11-16(26)12-9-15)20-19-17-7-5-4-6-14(17)10-13-18(19)31-23(29)25(20,24)22(28)30-2/h4-13,20H,3H2,1-2H3/t20-,24-,25-/m1/s1 |
| InChIKey | ZXPTXUOWQDMNMS-NIJXNBFTSA-N |
| XLogP | 5.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|