C28H15Br2FO6 — CID 99692149
(1S,1aR,7bS)-6-bromo-1a-(6-bromo-2-oxochromene-3-carbonyl)-1-(4-fluorobenzoyl)-1-methyl-7bH-cyclopropa[c]chromen-2-one (PubChem CID 99692149) has the molecular formula C28H15Br2FO6 and a molecular weight of 626.23 g/mol. Its IUPAC name is (1S,1aR,7bS)-6-bromo-1a-(6-bromo-2-oxochromene-3-carbonyl)-1-(4-fluorobenzoyl)-1-methyl-7bH-cyclopropa[c]chromen-2-one.
| Compound Name | (1S,1aR,7bS)-6-bromo-1a-(6-bromo-2-oxochromene-3-carbonyl)-1-(4-fluorobenzoyl)-1-methyl-7bH-cyclopropa[c]chromen-2-one |
|---|---|
| PubChem CID | 99692149 |
| Molecular Formula | C28H15Br2FO6 |
| Molecular Weight | 626.23 g/mol |
| Exact Mass | 623.92 |
| IUPAC Name | (1S,1aR,7bS)-6-bromo-1a-(6-bromo-2-oxochromene-3-carbonyl)-1-(4-fluorobenzoyl)-1-methyl-7bH-cyclopropa[c]chromen-2-one |
| SMILES | C[C@]1(C(=O)c2ccc(F)cc2)[C@@H]2c3cc(Br)ccc3OC(=O)[C@]21C(=O)c1cc2cc(Br)ccc2oc1=O |
| InChI | InChI=1S/C28H15Br2FO6/c1-27(23(32)13-2-6-17(31)7-3-13)22-18-12-16(30)5-9-21(18)37-26(35)28(22,27)24(33)19-11-14-10-15(29)4-8-20(14)36-25(19)34/h2-12,22H,1H3/t22-,27+,28+/m0/s1 |
| InChIKey | RYBLIVYAASQENC-XDAJTCOGSA-N |
| XLogP | 6.23 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.23 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|