C28H17FO6 — CID 26314450
(1R,1aS,7bS)-1-(4-fluorobenzoyl)-1-methyl-1a-(2-oxochromene-3-carbonyl)-7bH-cyclopropa[c]chromen-2-one (PubChem CID 26314450) has the molecular formula C28H17FO6 and a molecular weight of 468.44 g/mol. Its IUPAC name is (1R,1aS,7bS)-1-(4-fluorobenzoyl)-1-methyl-1a-(2-oxochromene-3-carbonyl)-7bH-cyclopropa[c]chromen-2-one.
| Compound Name | (1R,1aS,7bS)-1-(4-fluorobenzoyl)-1-methyl-1a-(2-oxochromene-3-carbonyl)-7bH-cyclopropa[c]chromen-2-one |
|---|---|
| PubChem CID | 26314450 |
| Molecular Formula | C28H17FO6 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (1R,1aS,7bS)-1-(4-fluorobenzoyl)-1-methyl-1a-(2-oxochromene-3-carbonyl)-7bH-cyclopropa[c]chromen-2-one |
| SMILES | C[C@@]1(C(=O)c2ccc(F)cc2)[C@@H]2c3ccccc3OC(=O)[C@@]21C(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C28H17FO6/c1-27(23(30)15-10-12-17(29)13-11-15)22-18-7-3-5-9-21(18)35-26(33)28(22,27)24(31)19-14-16-6-2-4-8-20(16)34-25(19)32/h2-14,22H,1H3/t22-,27-,28-/m0/s1 |
| InChIKey | GLZXPHLGBVQQOD-FAQZDJIUSA-N |
| XLogP | 4.71 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|