C20H16FNO3 — CID 3221339
N-cyclopropyl-N-[(4-fluorophenyl)methyl]-2-oxochromene-3-carboxamide (PubChem CID 3221339) has the molecular formula C20H16FNO3 and a molecular weight of 337.35 g/mol. Its IUPAC name is N-cyclopropyl-N-[(4-fluorophenyl)methyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-cyclopropyl-N-[(4-fluorophenyl)methyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 3221339 |
| Molecular Formula | C20H16FNO3 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-cyclopropyl-N-[(4-fluorophenyl)methyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(c1cc2ccccc2oc1=O)N(Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C20H16FNO3/c21-15-7-5-13(6-8-15)12-22(16-9-10-16)19(23)17-11-14-3-1-2-4-18(14)25-20(17)24/h1-8,11,16H,9-10,12H2 |
| InChIKey | CODFVLXKWBJNRP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|