C21H18FNO5S — CID 40643645
N-[(3S)-1,1-dioxothiolan-3-yl]-N-[(3-fluorophenyl)methyl]-2-oxochromene-3-carboxamide (PubChem CID 40643645) has the molecular formula C21H18FNO5S and a molecular weight of 415.44 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-[(3-fluorophenyl)methyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-[(3-fluorophenyl)methyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 40643645 |
| Molecular Formula | C21H18FNO5S |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-[(3-fluorophenyl)methyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(c1cc2ccccc2oc1=O)N(Cc1cccc(F)c1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H18FNO5S/c22-16-6-3-4-14(10-16)12-23(17-8-9-29(26,27)13-17)20(24)18-11-15-5-1-2-7-19(15)28-21(18)25/h1-7,10-11,17H,8-9,12-13H2/t17-/m0/s1 |
| InChIKey | KWKCYDLMWJRLAW-KRWDZBQOSA-N |
| XLogP | 2.76 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|