C21H17ClFNO5S — CID 18884158
N-[(2-chloro-6-fluorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-2-oxochromene-3-carboxamide (PubChem CID 18884158) has the molecular formula C21H17ClFNO5S and a molecular weight of 449.89 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-2-oxochromene-3-carboxamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 18884158 |
| Molecular Formula | C21H17ClFNO5S |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-2-oxochromene-3-carboxamide |
| SMILES | O=C(c1cc2ccccc2oc1=O)N(Cc1c(F)cccc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H17ClFNO5S/c22-17-5-3-6-18(23)16(17)11-24(14-8-9-30(27,28)12-14)20(25)15-10-13-4-1-2-7-19(13)29-21(15)26/h1-7,10,14H,8-9,11-12H2 |
| InChIKey | IYORMKYFBRWWDH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|