C18H16ClFN2O5S — CID 18884103
N-[(2-chloro-6-fluorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-2-nitrobenzamide (PubChem CID 18884103) has the molecular formula C18H16ClFN2O5S and a molecular weight of 426.85 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-2-nitrobenzamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 18884103 |
| Molecular Formula | C18H16ClFN2O5S |
| Molecular Weight | 426.85 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-2-nitrobenzamide |
| SMILES | O=C(c1ccccc1[N+](=O)[O-])N(Cc1c(F)cccc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H16ClFN2O5S/c19-15-5-3-6-16(20)14(15)10-21(12-8-9-28(26,27)11-12)18(23)13-4-1-2-7-17(13)22(24)25/h1-7,12H,8-11H2 |
| InChIKey | XSIPGTXAGBXAAN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.85 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|