C24H26N2O6S — CID 19243980
N-(1,1-dioxothiolan-3-yl)-2-oxo-N-[(5-piperidin-1-ylfuran-2-yl)methyl]chromene-3-carboxamide (PubChem CID 19243980) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-oxo-N-[(5-piperidin-1-ylfuran-2-yl)methyl]chromene-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-oxo-N-[(5-piperidin-1-ylfuran-2-yl)methyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 19243980 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-oxo-N-[(5-piperidin-1-ylfuran-2-yl)methyl]chromene-3-carboxamide |
| SMILES | O=C(c1cc2ccccc2oc1=O)N(Cc1ccc(N2CCCCC2)o1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C24H26N2O6S/c27-23(20-14-17-6-2-3-7-21(17)32-24(20)28)26(18-10-13-33(29,30)16-18)15-19-8-9-22(31-19)25-11-4-1-5-12-25/h2-3,6-9,14,18H,1,4-5,10-13,15-16H2 |
| InChIKey | NPISMAIEGGNXBY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 101.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|