C25H27NO5 — CID 3221341
N-cyclohexyl-N-[(3,4-dimethoxyphenyl)methyl]-2-oxochromene-3-carboxamide (PubChem CID 3221341) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is N-cyclohexyl-N-[(3,4-dimethoxyphenyl)methyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-cyclohexyl-N-[(3,4-dimethoxyphenyl)methyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 3221341 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-cyclohexyl-N-[(3,4-dimethoxyphenyl)methyl]-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc(CN(C(=O)c2cc3ccccc3oc2=O)C2CCCCC2)cc1OC |
| InChI | InChI=1S/C25H27NO5/c1-29-22-13-12-17(14-23(22)30-2)16-26(19-9-4-3-5-10-19)24(27)20-15-18-8-6-7-11-21(18)31-25(20)28/h6-8,11-15,19H,3-5,9-10,16H2,1-2H3 |
| InChIKey | OSJXMCGGIXVNMI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|