C23H27ClN2O4 — CID 22779364
N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-2-chloro-N-cyclohexylbenzamide (PubChem CID 22779364) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-2-chloro-N-cyclohexylbenzamide.
| Compound Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-2-chloro-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 22779364 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-2-chloro-N-cyclohexylbenzamide |
| SMILES | COc1cc(CN(C(=O)c2ccccc2Cl)C2CCCCC2)ccc1OCC(N)=O |
| InChI | InChI=1S/C23H27ClN2O4/c1-29-21-13-16(11-12-20(21)30-15-22(25)27)14-26(17-7-3-2-4-8-17)23(28)18-9-5-6-10-19(18)24/h5-6,9-13,17H,2-4,7-8,14-15H2,1H3,(H2,25,27) |
| InChIKey | MIDQYEYHEJDDDZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |