C24H28IN3O4S — CID 21170925
N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl-cyclohexylcarbamothioyl]-2-iodobenzamide (PubChem CID 21170925) has the molecular formula C24H28IN3O4S and a molecular weight of 581.48 g/mol. Its IUPAC name is N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl-cyclohexylcarbamothioyl]-2-iodobenzamide.
| Compound Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl-cyclohexylcarbamothioyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 21170925 |
| Molecular Formula | C24H28IN3O4S |
| Molecular Weight | 581.48 g/mol |
| Exact Mass | 581.08 |
| IUPAC Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl-cyclohexylcarbamothioyl]-2-iodobenzamide |
| SMILES | COc1cc(CN(C(=S)NC(=O)c2ccccc2I)C2CCCCC2)ccc1OCC(N)=O |
| InChI | InChI=1S/C24H28IN3O4S/c1-31-21-13-16(11-12-20(21)32-15-22(26)29)14-28(17-7-3-2-4-8-17)24(33)27-23(30)18-9-5-6-10-19(18)25/h5-6,9-13,17H,2-4,7-8,14-15H2,1H3,(H2,26,29)(H,27,30,33) |
| InChIKey | YHJWOTBSAFWGFD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|