C21H32N2O4 — CID 19629245
N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-N-cyclohexyl-3-methylbutanamide (PubChem CID 19629245) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-N-cyclohexyl-3-methylbutanamide.
| Compound Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-N-cyclohexyl-3-methylbutanamide |
|---|---|
| PubChem CID | 19629245 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-N-cyclohexyl-3-methylbutanamide |
| SMILES | COc1cc(CN(C(=O)CC(C)C)C2CCCCC2)ccc1OCC(N)=O |
| InChI | InChI=1S/C21H32N2O4/c1-15(2)11-21(25)23(17-7-5-4-6-8-17)13-16-9-10-18(19(12-16)26-3)27-14-20(22)24/h9-10,12,15,17H,4-8,11,13-14H2,1-3H3,(H2,22,24) |
| InChIKey | KZIZPVBNTWGNCC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |