C25H30ClN3O4S — CID 23100452
N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl-cyclohexylcarbamothioyl]-2-(4-chlorophenyl)acetamide (PubChem CID 23100452) has the molecular formula C25H30ClN3O4S and a molecular weight of 504.05 g/mol. Its IUPAC name is N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl-cyclohexylcarbamothioyl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl-cyclohexylcarbamothioyl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 23100452 |
| Molecular Formula | C25H30ClN3O4S |
| Molecular Weight | 504.05 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl-cyclohexylcarbamothioyl]-2-(4-chlorophenyl)acetamide |
| SMILES | COc1cc(CN(C(=S)NC(=O)Cc2ccc(Cl)cc2)C2CCCCC2)ccc1OCC(N)=O |
| InChI | InChI=1S/C25H30ClN3O4S/c1-32-22-13-18(9-12-21(22)33-16-23(27)30)15-29(20-5-3-2-4-6-20)25(34)28-24(31)14-17-7-10-19(26)11-8-17/h7-13,20H,2-6,14-16H2,1H3,(H2,27,30)(H,28,31,34) |
| InChIKey | VEPAVFMRUHOLHZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.05 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|