C24H29N3O7 — CID 23096806
2-[4-[[cyclohexyl-[2-(2-nitrophenoxy)acetyl]amino]methyl]-2-methoxyphenoxy]acetamide (PubChem CID 23096806) has the molecular formula C24H29N3O7 and a molecular weight of 471.51 g/mol. Its IUPAC name is 2-[4-[[cyclohexyl-[2-(2-nitrophenoxy)acetyl]amino]methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[[cyclohexyl-[2-(2-nitrophenoxy)acetyl]amino]methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 23096806 |
| Molecular Formula | C24H29N3O7 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 2-[4-[[cyclohexyl-[2-(2-nitrophenoxy)acetyl]amino]methyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(CN(C(=O)COc2ccccc2[N+](=O)[O-])C2CCCCC2)ccc1OCC(N)=O |
| InChI | InChI=1S/C24H29N3O7/c1-32-22-13-17(11-12-21(22)33-15-23(25)28)14-26(18-7-3-2-4-8-18)24(29)16-34-20-10-6-5-9-19(20)27(30)31/h5-6,9-13,18H,2-4,7-8,14-16H2,1H3,(H2,25,28) |
| InChIKey | ZSPWRGMVPGDGOP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|