C20H24N2O6 — CID 17417729
N-[3-(3,4-dimethoxyphenyl)propyl]-N-methyl-2-(2-nitrophenoxy)acetamide (PubChem CID 17417729) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)propyl]-N-methyl-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)propyl]-N-methyl-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 17417729 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)propyl]-N-methyl-2-(2-nitrophenoxy)acetamide |
| SMILES | COc1ccc(CCCN(C)C(=O)COc2ccccc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H24N2O6/c1-21(12-6-7-15-10-11-18(26-2)19(13-15)27-3)20(23)14-28-17-9-5-4-8-16(17)22(24)25/h4-5,8-11,13H,6-7,12,14H2,1-3H3 |
| InChIKey | ARCAXCFGNXJQHU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|