C16H20N3O4+ — CID 9311779
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-nitropyridin-1-ium-2-amine (PubChem CID 9311779) has the molecular formula C16H20N3O4+ and a molecular weight of 318.35 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-nitropyridin-1-ium-2-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-nitropyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9311779 |
| Molecular Formula | C16H20N3O4+ |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-nitropyridin-1-ium-2-amine |
| SMILES | COc1ccc(CCN(C)c2[nH+]cccc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H19N3O4/c1-18(16-13(19(20)21)5-4-9-17-16)10-8-12-6-7-14(22-2)15(11-12)23-3/h4-7,9,11H,8,10H2,1-3H3/p+1 |
| InChIKey | NWYJPXKQPUEELW-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 78.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|