C26H28N2O7S — CID 134868865
N-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-dimethoxy-N-[(Z)-2-[(R)-(2-nitrophenyl)sulfinyl]ethenyl]aniline (PubChem CID 134868865) has the molecular formula C26H28N2O7S and a molecular weight of 512.58 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-dimethoxy-N-[(Z)-2-[(R)-(2-nitrophenyl)sulfinyl]ethenyl]aniline.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-dimethoxy-N-[(Z)-2-[(R)-(2-nitrophenyl)sulfinyl]ethenyl]aniline |
|---|---|
| PubChem CID | 134868865 |
| Molecular Formula | C26H28N2O7S |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-dimethoxy-N-[(Z)-2-[(R)-(2-nitrophenyl)sulfinyl]ethenyl]aniline |
| SMILES | COc1ccc(CCN(/C=C\[S@@](=O)c2ccccc2[N+](=O)[O-])c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C26H28N2O7S/c1-32-22-11-9-19(17-24(22)34-3)13-14-27(20-10-12-23(33-2)25(18-20)35-4)15-16-36(31)26-8-6-5-7-21(26)28(29)30/h5-12,15-18H,13-14H2,1-4H3/b16-15-/t36-/m1/s1 |
| InChIKey | ZHTGFCJUQPHMEY-DLVZKOJSSA-N |
| XLogP | 4.96 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|