C15H16BrN3O4 — CID 71908121
3-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-nitropyridin-4-amine (PubChem CID 71908121) has the molecular formula C15H16BrN3O4 and a molecular weight of 382.21 g/mol. Its IUPAC name is 3-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-nitropyridin-4-amine.
| Compound Name | 3-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-nitropyridin-4-amine |
|---|---|
| PubChem CID | 71908121 |
| Molecular Formula | C15H16BrN3O4 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 3-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-nitropyridin-4-amine |
| SMILES | COc1ccc(CCNc2c(Br)cncc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H16BrN3O4/c1-22-13-4-3-10(7-14(13)23-2)5-6-18-15-11(16)8-17-9-12(15)19(20)21/h3-4,7-9H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | HUNQBQDVMLPMRW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|