C17H20N2O5 — CID 68917842
4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-2-nitrophenol (PubChem CID 68917842) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-2-nitrophenol.
| Compound Name | 4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-2-nitrophenol |
|---|---|
| PubChem CID | 68917842 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-2-nitrophenol |
| SMILES | COc1ccc(CCNCc2ccc(O)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C17H20N2O5/c1-23-16-6-4-12(10-17(16)24-2)7-8-18-11-13-3-5-15(20)14(9-13)19(21)22/h3-6,9-10,18,20H,7-8,11H2,1-2H3 |
| InChIKey | CTYHEMUDNVKHGS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|