C14H19NO5 — CID 43240316
4-[[2-(2-methoxyphenoxy)acetyl]-methylamino]butanoic acid (PubChem CID 43240316) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-[[2-(2-methoxyphenoxy)acetyl]-methylamino]butanoic acid.
| Compound Name | 4-[[2-(2-methoxyphenoxy)acetyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 43240316 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-[[2-(2-methoxyphenoxy)acetyl]-methylamino]butanoic acid |
| SMILES | COc1ccccc1OCC(=O)N(C)CCCC(=O)O |
| InChI | InChI=1S/C14H19NO5/c1-15(9-5-8-14(17)18)13(16)10-20-12-7-4-3-6-11(12)19-2/h3-4,6-7H,5,8-10H2,1-2H3,(H,17,18) |
| InChIKey | PKDFWMZBWOVEBO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |