C16H24N2O5 — CID 82151424
4-[3-[2-[butyl(methyl)amino]-2-oxoethoxy]-2-oxo-1-pyridinyl]butanoic acid (PubChem CID 82151424) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[3-[2-[butyl(methyl)amino]-2-oxoethoxy]-2-oxo-1-pyridinyl]butanoic acid.
| Compound Name | 4-[3-[2-[butyl(methyl)amino]-2-oxoethoxy]-2-oxo-1-pyridinyl]butanoic acid |
|---|---|
| PubChem CID | 82151424 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-[3-[2-[butyl(methyl)amino]-2-oxoethoxy]-2-oxo-1-pyridinyl]butanoic acid |
| SMILES | CCCCN(C)C(=O)COc1cccn(CCCC(=O)O)c1=O |
| InChI | InChI=1S/C16H24N2O5/c1-3-4-9-17(2)14(19)12-23-13-7-5-10-18(16(13)22)11-6-8-15(20)21/h5,7,10H,3-4,6,8-9,11-12H2,1-2H3,(H,20,21) |
| InChIKey | OTFYSNWXPCECPP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |