C19H23NO4 — CID 82151546
5-[2-oxo-3-(3-phenylpropoxy)-1-pyridinyl]pentanoic acid (PubChem CID 82151546) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 5-[2-oxo-3-(3-phenylpropoxy)-1-pyridinyl]pentanoic acid.
| Compound Name | 5-[2-oxo-3-(3-phenylpropoxy)-1-pyridinyl]pentanoic acid |
|---|---|
| PubChem CID | 82151546 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 5-[2-oxo-3-(3-phenylpropoxy)-1-pyridinyl]pentanoic acid |
| SMILES | O=C(O)CCCCn1cccc(OCCCc2ccccc2)c1=O |
| InChI | InChI=1S/C19H23NO4/c21-18(22)12-4-5-13-20-14-6-11-17(19(20)23)24-15-7-10-16-8-2-1-3-9-16/h1-3,6,8-9,11,14H,4-5,7,10,12-13,15H2,(H,21,22) |
| InChIKey | BMUOLVIWGYSVCB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|