C16H16ClNO4 — CID 94758137
4-[3-[(3-chlorophenyl)methoxy]-2-oxo-1-pyridinyl]butanoic acid (PubChem CID 94758137) has the molecular formula C16H16ClNO4 and a molecular weight of 321.76 g/mol. Its IUPAC name is 4-[3-[(3-chlorophenyl)methoxy]-2-oxo-1-pyridinyl]butanoic acid.
| Compound Name | 4-[3-[(3-chlorophenyl)methoxy]-2-oxo-1-pyridinyl]butanoic acid |
|---|---|
| PubChem CID | 94758137 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4-[3-[(3-chlorophenyl)methoxy]-2-oxo-1-pyridinyl]butanoic acid |
| SMILES | O=C(O)CCCn1cccc(OCc2cccc(Cl)c2)c1=O |
| InChI | InChI=1S/C16H16ClNO4/c17-13-5-1-4-12(10-13)11-22-14-6-2-8-18(16(14)21)9-3-7-15(19)20/h1-2,4-6,8,10H,3,7,9,11H2,(H,19,20) |
| InChIKey | VNECMRCTTOKAQZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |