C13H15Br2NO4 — CID 43092375
4-[[2-(2,4-dibromophenoxy)acetyl]-methylamino]butanoic acid (PubChem CID 43092375) has the molecular formula C13H15Br2NO4 and a molecular weight of 409.07 g/mol. Its IUPAC name is 4-[[2-(2,4-dibromophenoxy)acetyl]-methylamino]butanoic acid.
| Compound Name | 4-[[2-(2,4-dibromophenoxy)acetyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 43092375 |
| Molecular Formula | C13H15Br2NO4 |
| Molecular Weight | 409.07 g/mol |
| Exact Mass | 406.94 |
| IUPAC Name | 4-[[2-(2,4-dibromophenoxy)acetyl]-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H15Br2NO4/c1-16(6-2-3-13(18)19)12(17)8-20-11-5-4-9(14)7-10(11)15/h4-5,7H,2-3,6,8H2,1H3,(H,18,19) |
| InChIKey | ZTHPCXVOOKTEMK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.07 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |