C12H15Br2NO4 — CID 60655130
2-(2,4-dibromophenoxy)-N,N-bis(2-hydroxyethyl)acetamide (PubChem CID 60655130) has the molecular formula C12H15Br2NO4 and a molecular weight of 397.06 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-N,N-bis(2-hydroxyethyl)acetamide.
| Compound Name | 2-(2,4-dibromophenoxy)-N,N-bis(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 60655130 |
| Molecular Formula | C12H15Br2NO4 |
| Molecular Weight | 397.06 g/mol |
| Exact Mass | 394.94 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-N,N-bis(2-hydroxyethyl)acetamide |
| SMILES | O=C(COc1ccc(Br)cc1Br)N(CCO)CCO |
| InChI | InChI=1S/C12H15Br2NO4/c13-9-1-2-11(10(14)7-9)19-8-12(18)15(3-5-16)4-6-17/h1-2,7,16-17H,3-6,8H2 |
| InChIKey | HDKLDLVVODBTBO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.06 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |