C19H14BrNO5S2 — CID 98142058
(1R,2R,4R,5R,6R,15R,22S)-12-bromo-7,18-dioxo-8-oxa-17,21-dithia-19-azahexacyclo[13.7.0.02,6.04,22.09,14.016,20]docosa-9(14),10,12,16(20)-tetraene-5-carboxylic acid (PubChem CID 98142058) has the molecular formula C19H14BrNO5S2 and a molecular weight of 480.36 g/mol. Its IUPAC name is (1R,2R,4R,5R,6R,15R,22S)-12-bromo-7,18-dioxo-8-oxa-17,21-dithia-19-azahexacyclo[13.7.0.02,6.04,22.09,14.016,20]docosa-9(14),10,12,16(20)-tetraene-5-carboxylic acid.
| Compound Name | (1R,2R,4R,5R,6R,15R,22S)-12-bromo-7,18-dioxo-8-oxa-17,21-dithia-19-azahexacyclo[13.7.0.02,6.04,22.09,14.016,20]docosa-9(14),10,12,16(20)-tetraene-5-carboxylic acid |
|---|---|
| PubChem CID | 98142058 |
| Molecular Formula | C19H14BrNO5S2 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 478.95 |
| IUPAC Name | (1R,2R,4R,5R,6R,15R,22S)-12-bromo-7,18-dioxo-8-oxa-17,21-dithia-19-azahexacyclo[13.7.0.02,6.04,22.09,14.016,20]docosa-9(14),10,12,16(20)-tetraene-5-carboxylic acid |
| SMILES | O=C1Oc2ccc(Br)cc2[C@H]2c3sc(=O)[nH]c3S[C@@H]3[C@H]4C[C@@H]([C@@H]1[C@H]4C(=O)O)[C@H]23 |
| InChI | InChI=1S/C19H14BrNO5S2/c20-5-1-2-9-6(3-5)10-11-7-4-8(12(17(22)23)13(7)18(24)26-9)14(11)27-16-15(10)28-19(25)21-16/h1-3,7-8,10-14H,4H2,(H,21,25)(H,22,23)/t7-,8+,10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | ZMJMJBZJCZCMAU-VODBGLIXSA-N |
| XLogP | 3.31 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|