C26H21BrN2O4S2 — CID 98144510
(1R,2R,4S,5R,6S,15S,22R)-12-bromo-N-(4-methylphenyl)-7,18-dioxo-8-oxa-17,21-dithia-19-azahexacyclo[13.7.0.02,6.04,22.09,14.016,20]docosa-9(14),10,12,16(20)-tetraene-5-carboxamide (PubChem CID 98144510) has the molecular formula C26H21BrN2O4S2 and a molecular weight of 569.50 g/mol. Its IUPAC name is (1R,2R,4S,5R,6S,15S,22R)-12-bromo-N-(4-methylphenyl)-7,18-dioxo-8-oxa-17,21-dithia-19-azahexacyclo[13.7.0.02,6.04,22.09,14.016,20]docosa-9(14),10,12,16(20)-tetraene-5-carboxamide.
| Compound Name | (1R,2R,4S,5R,6S,15S,22R)-12-bromo-N-(4-methylphenyl)-7,18-dioxo-8-oxa-17,21-dithia-19-azahexacyclo[13.7.0.02,6.04,22.09,14.016,20]docosa-9(14),10,12,16(20)-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 98144510 |
| Molecular Formula | C26H21BrN2O4S2 |
| Molecular Weight | 569.50 g/mol |
| Exact Mass | 568.01 |
| IUPAC Name | (1R,2R,4S,5R,6S,15S,22R)-12-bromo-N-(4-methylphenyl)-7,18-dioxo-8-oxa-17,21-dithia-19-azahexacyclo[13.7.0.02,6.04,22.09,14.016,20]docosa-9(14),10,12,16(20)-tetraene-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2[C@H]3C[C@H]4[C@@H]2C(=O)Oc2ccc(Br)cc2[C@@H]2c5sc(=O)[nH]c5S[C@@H]3[C@@H]24)cc1 |
| InChI | InChI=1S/C26H21BrN2O4S2/c1-10-2-5-12(6-3-10)28-23(30)19-15-9-14-18-17(22-24(34-21(15)18)29-26(32)35-22)13-8-11(27)4-7-16(13)33-25(31)20(14)19/h2-8,14-15,17-21H,9H2,1H3,(H,28,30)(H,29,32)/t14-,15-,17+,18-,19+,20+,21+/m1/s1 |
| InChIKey | ZJBNAJABPRYLGC-HCDPMFRDSA-N |
| XLogP | 5.17 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|