C32H31BrN2O6S2 — CID 19252165
2-[(9S)-9-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid (PubChem CID 19252165) has the molecular formula C32H31BrN2O6S2 and a molecular weight of 683.65 g/mol. Its IUPAC name is 2-[(9S)-9-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid.
| Compound Name | 2-[(9S)-9-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 19252165 |
| Molecular Formula | C32H31BrN2O6S2 |
| Molecular Weight | 683.65 g/mol |
| Exact Mass | 682.08 |
| IUPAC Name | 2-[(9S)-9-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
| SMILES | Cc1ccc(COc2ccc(Br)cc2C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(C(C(=O)O)C(C)C)C(=O)C45)C23)cc1 |
| InChI | InChI=1S/C32H31BrN2O6S2/c1-13(2)25(31(38)39)35-29(36)23-18-11-19(24(23)30(35)37)26-22(18)21(27-28(42-26)34-32(40)43-27)17-10-16(33)8-9-20(17)41-12-15-6-4-14(3)5-7-15/h4-10,13,18-19,21-26H,11-12H2,1-3H3,(H,34,40)(H,38,39) |
| InChIKey | BAHHBDPBJBJECJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.65 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|