C33H26BrClN2O4S2 — CID 78578887
(9S)-9-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]-14-(4-chlorophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 78578887) has the molecular formula C33H26BrClN2O4S2 and a molecular weight of 694.07 g/mol. Its IUPAC name is (9S)-9-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]-14-(4-chlorophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (9S)-9-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]-14-(4-chlorophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 78578887 |
| Molecular Formula | C33H26BrClN2O4S2 |
| Molecular Weight | 694.07 g/mol |
| Exact Mass | 692.02 |
| IUPAC Name | (9S)-9-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]-14-(4-chlorophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | Cc1ccc(COc2ccc(Br)cc2C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(c6ccc(Cl)cc6)C(=O)C45)C23)cc1 |
| InChI | InChI=1S/C33H26BrClN2O4S2/c1-15-2-4-16(5-3-15)14-41-23-11-6-17(34)12-20(23)24-25-21-13-22(28(25)42-30-29(24)43-33(40)36-30)27-26(21)31(38)37(32(27)39)19-9-7-18(35)8-10-19/h2-12,21-22,24-28H,13-14H2,1H3,(H,36,40) |
| InChIKey | HRTXFJCFKVQKFW-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.07 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|