C33H26N4O8S2 — CID 78579251
(9S)-9-[2-[(4-methylphenyl)methoxy]-5-nitrophenyl]-14-(4-nitrophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 78579251) has the molecular formula C33H26N4O8S2 and a molecular weight of 670.73 g/mol. Its IUPAC name is (9S)-9-[2-[(4-methylphenyl)methoxy]-5-nitrophenyl]-14-(4-nitrophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (9S)-9-[2-[(4-methylphenyl)methoxy]-5-nitrophenyl]-14-(4-nitrophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 78579251 |
| Molecular Formula | C33H26N4O8S2 |
| Molecular Weight | 670.73 g/mol |
| Exact Mass | 670.12 |
| IUPAC Name | (9S)-9-[2-[(4-methylphenyl)methoxy]-5-nitrophenyl]-14-(4-nitrophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | Cc1ccc(COc2ccc([N+](=O)[O-])cc2C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(c6ccc([N+](=O)[O-])cc6)C(=O)C45)C23)cc1 |
| InChI | InChI=1S/C33H26N4O8S2/c1-15-2-4-16(5-3-15)14-45-23-11-10-19(37(43)44)12-20(23)24-25-21-13-22(28(25)46-30-29(24)47-33(40)34-30)27-26(21)31(38)35(32(27)39)17-6-8-18(9-7-17)36(41)42/h2-12,21-22,24-28H,13-14H2,1H3,(H,34,40) |
| InChIKey | YDGQZIIIHANTEZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 165.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.73 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|