C33H26FN3O6S2 — CID 43849690
(1R,11S)-14-(4-fluorophenyl)-9-[2-[(2-methylphenyl)methoxy]-5-nitrophenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 43849690) has the molecular formula C33H26FN3O6S2 and a molecular weight of 643.72 g/mol. Its IUPAC name is (1R,11S)-14-(4-fluorophenyl)-9-[2-[(2-methylphenyl)methoxy]-5-nitrophenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,11S)-14-(4-fluorophenyl)-9-[2-[(2-methylphenyl)methoxy]-5-nitrophenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 43849690 |
| Molecular Formula | C33H26FN3O6S2 |
| Molecular Weight | 643.72 g/mol |
| Exact Mass | 643.12 |
| IUPAC Name | (1R,11S)-14-(4-fluorophenyl)-9-[2-[(2-methylphenyl)methoxy]-5-nitrophenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | Cc1ccccc1COc1ccc([N+](=O)[O-])cc1C1c2sc(=O)[nH]c2SC2C1[C@H]1C[C@@H]2C2C(=O)N(c3ccc(F)cc3)C(=O)C21 |
| InChI | InChI=1S/C33H26FN3O6S2/c1-15-4-2-3-5-16(15)14-43-23-11-10-19(37(41)42)12-20(23)24-25-21-13-22(28(25)44-30-29(24)45-33(40)35-30)27-26(21)31(38)36(32(27)39)18-8-6-17(34)7-9-18/h2-12,21-22,24-28H,13-14H2,1H3,(H,35,40)/t21-,22-,24?,25?,26?,27?,28?/m1/s1 |
| InChIKey | XBAPHGMRZAKLBJ-JPBQIDROSA-N |
| XLogP | 6.05 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.72 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|