C36H32BrN3O7S2 — CID 19255946
2-[(9S)-9-[5-bromo-2-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid (PubChem CID 19255946) has the molecular formula C36H32BrN3O7S2 and a molecular weight of 762.70 g/mol. Its IUPAC name is 2-[(9S)-9-[5-bromo-2-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid.
| Compound Name | 2-[(9S)-9-[5-bromo-2-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 19255946 |
| Molecular Formula | C36H32BrN3O7S2 |
| Molecular Weight | 762.70 g/mol |
| Exact Mass | 761.09 |
| IUPAC Name | 2-[(9S)-9-[5-bromo-2-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N1C(=O)C2C3CC(C2C1=O)C1C(c2cc(Br)ccc2OCC(=O)Nc2ccc4ccccc4c2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C36H32BrN3O7S2/c1-15(2)29(35(44)45)40-33(42)27-21-13-22(28(27)34(40)43)30-26(21)25(31-32(48-30)39-36(46)49-31)20-12-18(37)8-10-23(20)47-14-24(41)38-19-9-7-16-5-3-4-6-17(16)11-19/h3-12,15,21-22,25-30H,13-14H2,1-2H3,(H,38,41)(H,39,46)(H,44,45) |
| InChIKey | PUKHFGKNHLZGQX-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.70 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|