C32H31ClN4O9S3 — CID 19255918
2-[(9S)-9-[5-chloro-2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid (PubChem CID 19255918) has the molecular formula C32H31ClN4O9S3 and a molecular weight of 747.27 g/mol. Its IUPAC name is 2-[(9S)-9-[5-chloro-2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid.
| Compound Name | 2-[(9S)-9-[5-chloro-2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 19255918 |
| Molecular Formula | C32H31ClN4O9S3 |
| Molecular Weight | 747.27 g/mol |
| Exact Mass | 746.09 |
| IUPAC Name | 2-[(9S)-9-[5-chloro-2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N1C(=O)C2C3CC(C2C1=O)C1C(c2cc(Cl)ccc2OCC(=O)Nc2ccc(S(N)(=O)=O)cc2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C32H31ClN4O9S3/c1-12(2)25(31(41)42)37-29(39)23-17-10-18(24(23)30(37)40)26-22(17)21(27-28(47-26)36-32(43)48-27)16-9-13(33)3-8-19(16)46-11-20(38)35-14-4-6-15(7-5-14)49(34,44)45/h3-9,12,17-18,21-26H,10-11H2,1-2H3,(H,35,38)(H,36,43)(H,41,42)(H2,34,44,45) |
| InChIKey | DOBDSWUBHVOSTN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 206.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|