C33H34N4O10S3 — CID 19255864
2-[(9S)-9-[3-methoxy-4-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid (PubChem CID 19255864) has the molecular formula C33H34N4O10S3 and a molecular weight of 742.85 g/mol. Its IUPAC name is 2-[(9S)-9-[3-methoxy-4-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid.
| Compound Name | 2-[(9S)-9-[3-methoxy-4-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 19255864 |
| Molecular Formula | C33H34N4O10S3 |
| Molecular Weight | 742.85 g/mol |
| Exact Mass | 742.14 |
| IUPAC Name | 2-[(9S)-9-[3-methoxy-4-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(C(C(=O)O)C(C)C)C(=O)C45)C23)ccc1OCC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C33H34N4O10S3/c1-13(2)26(32(41)42)37-30(39)24-17-11-18(25(24)31(37)40)27-23(17)22(28-29(48-27)36-33(43)49-28)14-4-9-19(20(10-14)46-3)47-12-21(38)35-15-5-7-16(8-6-15)50(34,44)45/h4-10,13,17-18,22-27H,11-12H2,1-3H3,(H,35,38)(H,36,43)(H,41,42)(H2,34,44,45) |
| InChIKey | LXJNRANRQCDOFY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 215.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.85 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|