C38H37N3O8S2 — CID 19255891
2-[(9S)-9-[3-ethoxy-4-[2-(naphthalen-1-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid (PubChem CID 19255891) has the molecular formula C38H37N3O8S2 and a molecular weight of 727.86 g/mol. Its IUPAC name is 2-[(9S)-9-[3-ethoxy-4-[2-(naphthalen-1-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid.
| Compound Name | 2-[(9S)-9-[3-ethoxy-4-[2-(naphthalen-1-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 19255891 |
| Molecular Formula | C38H37N3O8S2 |
| Molecular Weight | 727.86 g/mol |
| Exact Mass | 727.20 |
| IUPAC Name | 2-[(9S)-9-[3-ethoxy-4-[2-(naphthalen-1-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
| SMILES | CCOc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(C(C(=O)O)C(C)C)C(=O)C45)C23)ccc1OCC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C38H37N3O8S2/c1-4-48-25-14-19(12-13-24(25)49-16-26(42)39-23-11-7-9-18-8-5-6-10-20(18)23)27-28-21-15-22(32(28)50-34-33(27)51-38(47)40-34)30-29(21)35(43)41(36(30)44)31(17(2)3)37(45)46/h5-14,17,21-22,27-32H,4,15-16H2,1-3H3,(H,39,42)(H,40,47)(H,45,46) |
| InChIKey | KHMYYDCCZOJHSH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 155.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.86 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|