C33H30F3N3O7S2 — CID 19255850
3-methyl-2-[(9S)-6,13,15-trioxo-9-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid (PubChem CID 19255850) has the molecular formula C33H30F3N3O7S2 and a molecular weight of 701.74 g/mol. Its IUPAC name is 3-methyl-2-[(9S)-6,13,15-trioxo-9-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid.
| Compound Name | 3-methyl-2-[(9S)-6,13,15-trioxo-9-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
|---|---|
| PubChem CID | 19255850 |
| Molecular Formula | C33H30F3N3O7S2 |
| Molecular Weight | 701.74 g/mol |
| Exact Mass | 701.15 |
| IUPAC Name | 3-methyl-2-[(9S)-6,13,15-trioxo-9-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
| SMILES | CC(C)C(C(=O)O)N1C(=O)C2C3CC(C2C1=O)C1C(c2cccc(OCC(=O)Nc4ccccc4C(F)(F)F)c2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C33H30F3N3O7S2/c1-13(2)25(31(43)44)39-29(41)23-16-11-17(24(23)30(39)42)26-22(16)21(27-28(47-26)38-32(45)48-27)14-6-5-7-15(10-14)46-12-20(40)37-19-9-4-3-8-18(19)33(34,35)36/h3-10,13,16-17,21-26H,11-12H2,1-2H3,(H,37,40)(H,38,45)(H,43,44) |
| InChIKey | YUPUKHMVYZJMPT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.74 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|