C32H32N4O9S3 — CID 19255846
3-methyl-2-[(9S)-6,13,15-trioxo-9-[3-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid (PubChem CID 19255846) has the molecular formula C32H32N4O9S3 and a molecular weight of 712.83 g/mol. Its IUPAC name is 3-methyl-2-[(9S)-6,13,15-trioxo-9-[3-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid.
| Compound Name | 3-methyl-2-[(9S)-6,13,15-trioxo-9-[3-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
|---|---|
| PubChem CID | 19255846 |
| Molecular Formula | C32H32N4O9S3 |
| Molecular Weight | 712.83 g/mol |
| Exact Mass | 712.13 |
| IUPAC Name | 3-methyl-2-[(9S)-6,13,15-trioxo-9-[3-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
| SMILES | CC(C)C(C(=O)O)N1C(=O)C2C3CC(C2C1=O)C1C(c2cccc(OCC(=O)Nc4ccc(S(N)(=O)=O)cc4)c2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C32H32N4O9S3/c1-13(2)25(31(40)41)36-29(38)23-18-11-19(24(23)30(36)39)26-22(18)21(27-28(46-26)35-32(42)47-27)14-4-3-5-16(10-14)45-12-20(37)34-15-6-8-17(9-7-15)48(33,43)44/h3-10,13,18-19,21-26H,11-12H2,1-2H3,(H,34,37)(H,35,42)(H,40,41)(H2,33,43,44) |
| InChIKey | UIKDSEUWCORRKQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 206.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.83 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|