C31H35N3O7S2 — CID 19255847
3-methyl-2-[(9S)-6,13,15-trioxo-9-[3-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid (PubChem CID 19255847) has the molecular formula C31H35N3O7S2 and a molecular weight of 625.77 g/mol. Its IUPAC name is 3-methyl-2-[(9S)-6,13,15-trioxo-9-[3-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid.
| Compound Name | 3-methyl-2-[(9S)-6,13,15-trioxo-9-[3-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
|---|---|
| PubChem CID | 19255847 |
| Molecular Formula | C31H35N3O7S2 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | 3-methyl-2-[(9S)-6,13,15-trioxo-9-[3-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
| SMILES | CC(C)C(C(=O)O)N1C(=O)C2C3CC(C2C1=O)C1C(c2cccc(OCC(=O)N4CCCCC4)c2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C31H35N3O7S2/c1-14(2)24(30(38)39)34-28(36)22-17-12-18(23(22)29(34)37)25-21(17)20(26-27(42-25)32-31(40)43-26)15-7-6-8-16(11-15)41-13-19(35)33-9-4-3-5-10-33/h6-8,11,14,17-18,20-25H,3-5,9-10,12-13H2,1-2H3,(H,32,40)(H,38,39) |
| InChIKey | ZVGGVZVQZCPHOA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|