C24H23FN2O5S2 — CID 124825375
(2R)-2-[(1R,2R,9S,10R,11S,12S,16S)-9-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid (PubChem CID 124825375) has the molecular formula C24H23FN2O5S2 and a molecular weight of 502.59 g/mol. Its IUPAC name is (2R)-2-[(1R,2R,9S,10R,11S,12S,16S)-9-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(1R,2R,9S,10R,11S,12S,16S)-9-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 124825375 |
| Molecular Formula | C24H23FN2O5S2 |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | (2R)-2-[(1R,2R,9S,10R,11S,12S,16S)-9-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](C(=O)O)N1C(=O)[C@@H]2[C@H]3C[C@@H]([C@@H]2C1=O)[C@@H]1[C@@H](c2ccc(F)cc2)c2sc(=O)[nH]c2S[C@H]31 |
| InChI | InChI=1S/C24H23FN2O5S2/c1-8(2)17(23(30)31)27-21(28)15-11-7-12(16(15)22(27)29)18-14(11)13(9-3-5-10(25)6-4-9)19-20(33-18)26-24(32)34-19/h3-6,8,11-18H,7H2,1-2H3,(H,26,32)(H,30,31)/t11-,12-,13-,14-,15+,16-,17-,18-/m1/s1 |
| InChIKey | WBCREZAIJXHMHW-UISAILPVSA-N |
| XLogP | 3.16 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|