C25H25ClN2O5S2 — CID 19252189
2-[(9S)-9-(4-chlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-4-methylpentanoic acid (PubChem CID 19252189) has the molecular formula C25H25ClN2O5S2 and a molecular weight of 533.07 g/mol. Its IUPAC name is 2-[(9S)-9-(4-chlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-4-methylpentanoic acid.
| Compound Name | 2-[(9S)-9-(4-chlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 19252189 |
| Molecular Formula | C25H25ClN2O5S2 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | 2-[(9S)-9-(4-chlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)N1C(=O)C2C3CC(C2C1=O)C1C(c2ccc(Cl)cc2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C25H25ClN2O5S2/c1-9(2)7-14(24(31)32)28-22(29)17-12-8-13(18(17)23(28)30)19-16(12)15(10-3-5-11(26)6-4-10)20-21(34-19)27-25(33)35-20/h3-6,9,12-19H,7-8H2,1-2H3,(H,27,33)(H,31,32) |
| InChIKey | PGFNGLMRWLYAIC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|