C31H30N2O5S2 — CID 16558083
4-methyl-2-[6,13,15-trioxo-9-(4-phenylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]pentanoic acid (PubChem CID 16558083) has the molecular formula C31H30N2O5S2 and a molecular weight of 574.72 g/mol. Its IUPAC name is 4-methyl-2-[6,13,15-trioxo-9-(4-phenylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]pentanoic acid.
| Compound Name | 4-methyl-2-[6,13,15-trioxo-9-(4-phenylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]pentanoic acid |
|---|---|
| PubChem CID | 16558083 |
| Molecular Formula | C31H30N2O5S2 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 4-methyl-2-[6,13,15-trioxo-9-(4-phenylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]pentanoic acid |
| SMILES | CC(C)CC(C(=O)O)N1C(=O)C2C3CC(C2C1=O)C1C(c2ccc(-c4ccccc4)cc2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C31H30N2O5S2/c1-14(2)12-20(30(36)37)33-28(34)23-18-13-19(24(23)29(33)35)25-22(18)21(26-27(39-25)32-31(38)40-26)17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-11,14,18-25H,12-13H2,1-2H3,(H,32,38)(H,36,37) |
| InChIKey | IFTFYMQWROUADI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|