C31H30N2O5S2 — CID 18862025
propan-2-yl 2-[6,13,15-trioxo-9-(4-phenylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoate (PubChem CID 18862025) has the molecular formula C31H30N2O5S2 and a molecular weight of 574.72 g/mol. Its IUPAC name is propan-2-yl 2-[6,13,15-trioxo-9-(4-phenylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoate.
| Compound Name | propan-2-yl 2-[6,13,15-trioxo-9-(4-phenylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoate |
|---|---|
| PubChem CID | 18862025 |
| Molecular Formula | C31H30N2O5S2 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | propan-2-yl 2-[6,13,15-trioxo-9-(4-phenylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoate |
| SMILES | CC(C)OC(=O)C(C)N1C(=O)C2C3CC(C2C1=O)C1C(c2ccc(-c4ccccc4)cc2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C31H30N2O5S2/c1-14(2)38-30(36)15(3)33-28(34)23-19-13-20(24(23)29(33)35)25-22(19)21(26-27(39-25)32-31(37)40-26)18-11-9-17(10-12-18)16-7-5-4-6-8-16/h4-12,14-15,19-25H,13H2,1-3H3,(H,32,37) |
| InChIKey | YYDBSYBKCKASAE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|